About (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione
(8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione (PubChem CID 130455178) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione.
Molecular Properties
| Compound Name | (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione |
| PubChem CID | 130455178 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione |
| SMILES | O=C1C/C=C/CCCC2C=CC(=O)C2COCC1 |
| InChI | InChI=1S/C15H20O3/c16-13-6-4-2-1-3-5-12-7-8-15(17)14(12)11-18-10-9-13/h2,4,7-8,12,14H,1,3,5-6,9-11H2/b4-2+ |
| InChIKey | LZBSTPNJINFYFM-DUXPYHPUSA-N |
| XLogP | 2.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione?
The IUPAC name of (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione (CID 130455178) is (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione.
What is the SMILES notation for (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione?
The canonical SMILES for (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione is O=C1C/C=C/CCCC2C=CC(=O)C2COCC1.
What is the InChIKey of (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione?
The InChIKey is LZBSTPNJINFYFM-DUXPYHPUSA-N. The full InChI is InChI=1S/C15H20O3/c16-13-6-4-2-1-3-5-12-7-8-15(17)14(12)11-18-10-9-13/h2,4,7-8,12,14H,1,3,5-6,9-11H2/b4-2+.
What are the key properties of (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione?
(8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione has a molecular weight of 248.32 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8E)-3-oxabicyclo[11.3.0]hexadeca-8,14-diene-6,16-dione is sourced from PubChem (CID 130455178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).