About 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine
7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine (PubChem CID 130455584) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine |
| PubChem CID | 130455584 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine |
| SMILES | CC(C)(C)Cc1cncc2[nH]cnc12 |
| InChI | InChI=1S/C11H15N3/c1-11(2,3)4-8-5-12-6-9-10(8)14-7-13-9/h5-7H,4H2,1-3H3,(H,13,14) |
| InChIKey | NKYYITGNGABECH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine?
The IUPAC name of 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine (CID 130455584) is 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine is CC(C)(C)Cc1cncc2[nH]cnc12.
What is the InChIKey of 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine?
The InChIKey is NKYYITGNGABECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-11(2,3)4-8-5-12-6-9-10(8)14-7-13-9/h5-7H,4H2,1-3H3,(H,13,14).
What are the key properties of 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine?
7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine has a molecular weight of 189.26 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-dimethylpropyl)-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 130455584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).