C8H6O5 — CID 130455593
4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione (PubChem CID 130455593) has the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. Its IUPAC name is 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione.
| Compound Name | 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione |
|---|---|
| PubChem CID | 130455593 |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione |
| SMILES | O=C1OCC2C1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C8H6O5/c9-6-3-2(1-12-6)4-5(3)8(11)13-7(4)10/h2-5H,1H2 |
| InChIKey | CEKOJMQDFMWZSM-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|