About 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole
7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole (PubChem CID 130455671) has the molecular formula C18H22F2N2
and a molecular weight of 304.38 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole.
Molecular Properties
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole |
| PubChem CID | 130455671 |
| Molecular Formula | C18H22F2N2 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole |
| SMILES | C=C/C=C\C1=C(F)C(CCC2(F)CCCCC2)n2cncc21 |
| InChI | InChI=1S/C18H22F2N2/c1-2-3-7-14-16-12-21-13-22(16)15(17(14)19)8-11-18(20)9-5-4-6-10-18/h2-3,7,12-13,15H,1,4-6,8-11H2/b7-3- |
| InChIKey | ZMDZITBMTFIKGA-CLTKARDFSA-N |
| XLogP | 5.31 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole?
The IUPAC name of 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole (CID 130455671) is 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole.
What is the SMILES notation for 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole?
The canonical SMILES for 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole is C=C/C=C\C1=C(F)C(CCC2(F)CCCCC2)n2cncc21.
What is the InChIKey of 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole?
The InChIKey is ZMDZITBMTFIKGA-CLTKARDFSA-N. The full InChI is InChI=1S/C18H22F2N2/c1-2-3-7-14-16-12-21-13-22(16)15(17(14)19)8-11-18(20)9-5-4-6-10-18/h2-3,7,12-13,15H,1,4-6,8-11H2/b7-3-.
What are the key properties of 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole?
7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole has a molecular weight of 304.38 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1Z)-buta-1,3-dienyl]-6-fluoro-5-[2-(1-fluorocyclohexyl)ethyl]-5H-pyrrolo[1,2-c]imidazole is sourced from PubChem (CID 130455671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).