C22H24F3N7O3 — CID 130455672
N-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]-8-(2,2,2-trifluoroethyl)spiro[6H-pyrimido[5,4-b][1,4]oxazine-7,4'-oxane]-2-amine (PubChem CID 130455672) has the molecular formula C22H24F3N7O3 and a molecular weight of 491.47 g/mol. Its IUPAC name is N-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]-8-(2,2,2-trifluoroethyl)spiro[6H-pyrimido[5,4-b][1,4]oxazine-7,4'-oxane]-2-amine.
| Compound Name | N-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]-8-(2,2,2-trifluoroethyl)spiro[6H-pyrimido[5,4-b][1,4]oxazine-7,4'-oxane]-2-amine |
|---|---|
| PubChem CID | 130455672 |
| Molecular Formula | C22H24F3N7O3 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[5-methoxy-6-(4-methylimidazol-1-yl)-3-pyridinyl]-8-(2,2,2-trifluoroethyl)spiro[6H-pyrimido[5,4-b][1,4]oxazine-7,4'-oxane]-2-amine |
| SMILES | COc1cc(Nc2ncc3c(n2)N(CC(F)(F)F)C2(CCOCC2)CO3)cnc1-n1cnc(C)c1 |
| InChI | InChI=1S/C22H24F3N7O3/c1-14-10-31(13-28-14)18-16(33-2)7-15(8-26-18)29-20-27-9-17-19(30-20)32(11-22(23,24)25)21(12-35-17)3-5-34-6-4-21/h7-10,13H,3-6,11-12H2,1-2H3,(H,27,29,30) |
| InChIKey | UJGZZPPAYGJIAX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |