About 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole
5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole (PubChem CID 130455684) has the molecular formula C18H23FN2
and a molecular weight of 286.39 g/mol. Its IUPAC name is 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole.
Molecular Properties
| Compound Name | 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole |
| PubChem CID | 130455684 |
| Molecular Formula | C18H23FN2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole |
| SMILES | FC(CC1C2C=CC=CC2c2cncn21)C1CCCCC1 |
| InChI | InChI=1S/C18H23FN2/c19-16(13-6-2-1-3-7-13)10-17-14-8-4-5-9-15(14)18-11-20-12-21(17)18/h4-5,8-9,11-17H,1-3,6-7,10H2 |
| InChIKey | GHJUARMZJDNTGA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole?
The IUPAC name of 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole (CID 130455684) is 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole.
What is the SMILES notation for 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole?
The canonical SMILES for 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole is FC(CC1C2C=CC=CC2c2cncn21)C1CCCCC1.
What is the InChIKey of 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole?
The InChIKey is GHJUARMZJDNTGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN2/c19-16(13-6-2-1-3-7-13)10-17-14-8-4-5-9-15(14)18-11-20-12-21(17)18/h4-5,8-9,11-17H,1-3,6-7,10H2.
What are the key properties of 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole?
5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole has a molecular weight of 286.39 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclohexyl-2-fluoroethyl)-5a,9a-dihydro-5H-imidazo[5,1-a]isoindole is sourced from PubChem (CID 130455684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).