C19H23F2N3O4S — CID 130455724
[1-(4,4-difluorocyclohexyl)-2-(10-methoxy-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethyl] methanesulfonate (PubChem CID 130455724) has the molecular formula C19H23F2N3O4S and a molecular weight of 427.47 g/mol. Its IUPAC name is [1-(4,4-difluorocyclohexyl)-2-(10-methoxy-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethyl] methanesulfonate.
| Compound Name | [1-(4,4-difluorocyclohexyl)-2-(10-methoxy-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 130455724 |
| Molecular Formula | C19H23F2N3O4S |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [1-(4,4-difluorocyclohexyl)-2-(10-methoxy-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethyl] methanesulfonate |
| SMILES | COc1ccc2c(n1)C(CC(OS(C)(=O)=O)C1CCC(F)(F)CC1)n1cncc1-2 |
| InChI | InChI=1S/C19H23F2N3O4S/c1-27-17-4-3-13-15-10-22-11-24(15)14(18(13)23-17)9-16(28-29(2,25)26)12-5-7-19(20,21)8-6-12/h3-4,10-12,14,16H,5-9H2,1-2H3 |
| InChIKey | LVODBQNOGWJIHO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|