C27H38O10 — CID 130455807
[13-[(E)-but-2-enoyl]oxy-5,6,11-trihydroxy-4-(hydroxymethyl)-8,14,15-trimethyl-7-oxo-3-oxatetracyclo[9.4.0.02,4.06,10]pentadec-8-en-14-yl] 2-methylbutanoate (PubChem CID 130455807) has the molecular formula C27H38O10 and a molecular weight of 522.59 g/mol. Its IUPAC name is [13-[(E)-but-2-enoyl]oxy-5,6,11-trihydroxy-4-(hydroxymethyl)-8,14,15-trimethyl-7-oxo-3-oxatetracyclo[9.4.0.02,4.06,10]pentadec-8-en-14-yl] 2-methylbutanoate.
| Compound Name | [13-[(E)-but-2-enoyl]oxy-5,6,11-trihydroxy-4-(hydroxymethyl)-8,14,15-trimethyl-7-oxo-3-oxatetracyclo[9.4.0.02,4.06,10]pentadec-8-en-14-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 130455807 |
| Molecular Formula | C27H38O10 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | [13-[(E)-but-2-enoyl]oxy-5,6,11-trihydroxy-4-(hydroxymethyl)-8,14,15-trimethyl-7-oxo-3-oxatetracyclo[9.4.0.02,4.06,10]pentadec-8-en-14-yl] 2-methylbutanoate |
| SMILES | C/C=C/C(=O)OC1CC2(O)C(C(C)C1(C)OC(=O)C(C)CC)C1OC1(CO)C(O)C1(O)C(=O)C(C)=CC21 |
| InChI | InChI=1S/C27H38O10/c1-7-9-18(29)35-17-11-25(33)16-10-14(4)20(30)27(16,34)23(32)26(12-28)21(36-26)19(25)15(5)24(17,6)37-22(31)13(3)8-2/h7,9-10,13,15-17,19,21,23,28,32-34H,8,11-12H2,1-6H3/b9-7+ |
| InChIKey | FCWNPFDSBXSYSN-VQHVLOKHSA-N |
| XLogP | 0.59 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|