C15H27NO3 — CID 130455914
tert-butyl N-[(2R,3R,5S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamate (PubChem CID 130455914) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,5S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,5S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamate |
|---|---|
| PubChem CID | 130455914 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | tert-butyl N-[(2R,3R,5S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamate |
| SMILES | C=CCC1O[C@H](C)[C@H](NC(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C15H27NO3/c1-7-8-13-10(2)9-12(11(3)18-13)16-14(17)19-15(4,5)6/h7,10-13H,1,8-9H2,2-6H3,(H,16,17)/t10-,11+,12+,13?/m0/s1 |
| InChIKey | XZOYPHIIEILQHM-VCKSIFHUSA-N |
| XLogP | 3.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|