C8H16NO4PS — CID 130456089
S-methyl N-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-N-methylcarbamothioate (PubChem CID 130456089) has the molecular formula C8H16NO4PS and a molecular weight of 253.26 g/mol. Its IUPAC name is S-methyl N-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-N-methylcarbamothioate.
| Compound Name | S-methyl N-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-N-methylcarbamothioate |
|---|---|
| PubChem CID | 130456089 |
| Molecular Formula | C8H16NO4PS |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | S-methyl N-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-N-methylcarbamothioate |
| SMILES | CSC(=O)N(C)P1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C8H16NO4PS/c1-8(2)5-12-14(11,13-6-8)9(3)7(10)15-4/h5-6H2,1-4H3 |
| InChIKey | RVFVNKFUQLCZDC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|