C14H22O10 — CID 130456403
(3S,3aR,6R,6aR)-5-[(3S,4S)-4-[(3S,4R)-4-hydroxyoxolan-3-yl]peroxyoxolan-3-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol (PubChem CID 130456403) has the molecular formula C14H22O10 and a molecular weight of 350.32 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-5-[(3S,4S)-4-[(3S,4R)-4-hydroxyoxolan-3-yl]peroxyoxolan-3-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol.
| Compound Name | (3S,3aR,6R,6aR)-5-[(3S,4S)-4-[(3S,4R)-4-hydroxyoxolan-3-yl]peroxyoxolan-3-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol |
|---|---|
| PubChem CID | 130456403 |
| Molecular Formula | C14H22O10 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (3S,3aR,6R,6aR)-5-[(3S,4S)-4-[(3S,4R)-4-hydroxyoxolan-3-yl]peroxyoxolan-3-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol |
| SMILES | O[C@@H]1COC[C@@H]1OO[C@H]1COC[C@@H]1OC1O[C@H]2[C@H](OC[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C14H22O10/c15-6-1-18-3-8(6)23-24-10-5-19-4-9(10)21-14-11(17)13-12(22-14)7(16)2-20-13/h6-17H,1-5H2/t6-,7+,8+,9+,10+,11-,12-,13-,14?/m1/s1 |
| InChIKey | NCHSBAPBTVEWFX-OCEPJTJBSA-N |
| XLogP | -2.68 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|