C16H25N5O3S — CID 130456434
2-[3-[[2-[(3,3-dimethylpyrrolidine-2-carbonyl)amino]acetyl]amino]propyl]-1,3-thiazole-4-carboxamide (PubChem CID 130456434) has the molecular formula C16H25N5O3S and a molecular weight of 367.48 g/mol. Its IUPAC name is 2-[3-[[2-[(3,3-dimethylpyrrolidine-2-carbonyl)amino]acetyl]amino]propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[3-[[2-[(3,3-dimethylpyrrolidine-2-carbonyl)amino]acetyl]amino]propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 130456434 |
| Molecular Formula | C16H25N5O3S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[3-[[2-[(3,3-dimethylpyrrolidine-2-carbonyl)amino]acetyl]amino]propyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC1(C)CCNC1C(=O)NCC(=O)NCCCc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C16H25N5O3S/c1-16(2)5-7-19-13(16)15(24)20-8-11(22)18-6-3-4-12-21-10(9-25-12)14(17)23/h9,13,19H,3-8H2,1-2H3,(H2,17,23)(H,18,22)(H,20,24) |
| InChIKey | ZMUYNNQAFKJPCQ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|