C14H22F6O4 — CID 130456523
(2S,3S,5S,6S)-3,6-ditert-butyl-2,5-bis(trifluoromethyl)-1,4-dioxane-2,5-diol (PubChem CID 130456523) has the molecular formula C14H22F6O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is (2S,3S,5S,6S)-3,6-ditert-butyl-2,5-bis(trifluoromethyl)-1,4-dioxane-2,5-diol.
| Compound Name | (2S,3S,5S,6S)-3,6-ditert-butyl-2,5-bis(trifluoromethyl)-1,4-dioxane-2,5-diol |
|---|---|
| PubChem CID | 130456523 |
| Molecular Formula | C14H22F6O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2S,3S,5S,6S)-3,6-ditert-butyl-2,5-bis(trifluoromethyl)-1,4-dioxane-2,5-diol |
| SMILES | CC(C)(C)[C@@H]1O[C@](O)(C(F)(F)F)[C@H](C(C)(C)C)O[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C14H22F6O4/c1-9(2,3)7-11(21,13(15,16)17)24-8(10(4,5)6)12(22,23-7)14(18,19)20/h7-8,21-22H,1-6H3/t7-,8-,11-,12-/m0/s1 |
| InChIKey | PGYZQHUONCZGTB-OSTYVCCYSA-N |
| XLogP | 3.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |