C21H30O6S — CID 130456762
5,7,12,12,14,14-hexamethylspiro[10-oxa-2-thiabicyclo[6.3.3]tetradecane-4,3'-oxolane]-2',5',9,11-tetrone (PubChem CID 130456762) has the molecular formula C21H30O6S and a molecular weight of 410.53 g/mol. Its IUPAC name is 5,7,12,12,14,14-hexamethylspiro[10-oxa-2-thiabicyclo[6.3.3]tetradecane-4,3'-oxolane]-2',5',9,11-tetrone.
| Compound Name | 5,7,12,12,14,14-hexamethylspiro[10-oxa-2-thiabicyclo[6.3.3]tetradecane-4,3'-oxolane]-2',5',9,11-tetrone |
|---|---|
| PubChem CID | 130456762 |
| Molecular Formula | C21H30O6S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 5,7,12,12,14,14-hexamethylspiro[10-oxa-2-thiabicyclo[6.3.3]tetradecane-4,3'-oxolane]-2',5',9,11-tetrone |
| SMILES | CC1CC(C)C2(CSC3C(=O)OC(=O)C1C(C)(C)CC3(C)C)CC(=O)OC2=O |
| InChI | InChI=1S/C21H30O6S/c1-11-7-12(2)21(8-13(22)26-18(21)25)10-28-15-17(24)27-16(23)14(11)19(3,4)9-20(15,5)6/h11-12,14-15H,7-10H2,1-6H3 |
| InChIKey | RSJMVMZVADZMAL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|