About 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one
2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one (PubChem CID 130457040) has the molecular formula C10H18F2O2
and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one |
| PubChem CID | 130457040 |
| Molecular Formula | C10H18F2O2 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one |
| SMILES | CCC(C)C(=O)C(C)(C)OCC(F)F |
| InChI | InChI=1S/C10H18F2O2/c1-5-7(2)9(13)10(3,4)14-6-8(11)12/h7-8H,5-6H2,1-4H3 |
| InChIKey | VJQMGUATVCTAAS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one?
The IUPAC name of 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one (CID 130457040) is 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one.
What is the SMILES notation for 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one?
The canonical SMILES for 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one is CCC(C)C(=O)C(C)(C)OCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one?
The InChIKey is VJQMGUATVCTAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2O2/c1-5-7(2)9(13)10(3,4)14-6-8(11)12/h7-8H,5-6H2,1-4H3.
What are the key properties of 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one?
2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one has a molecular weight of 208.25 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)-2,4-dimethylhexan-3-one is sourced from PubChem (CID 130457040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).