C13H22F2O2 — CID 130457264
2-(5,5-difluorooxan-2-yl)-2,4-dimethylhexan-3-one (PubChem CID 130457264) has the molecular formula C13H22F2O2 and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-(5,5-difluorooxan-2-yl)-2,4-dimethylhexan-3-one.
| Compound Name | 2-(5,5-difluorooxan-2-yl)-2,4-dimethylhexan-3-one |
|---|---|
| PubChem CID | 130457264 |
| Molecular Formula | C13H22F2O2 |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-(5,5-difluorooxan-2-yl)-2,4-dimethylhexan-3-one |
| SMILES | CCC(C)C(=O)C(C)(C)C1CCC(F)(F)CO1 |
| InChI | InChI=1S/C13H22F2O2/c1-5-9(2)11(16)12(3,4)10-6-7-13(14,15)8-17-10/h9-10H,5-8H2,1-4H3 |
| InChIKey | NODZVFOEHUZJCR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |