C25H38O7 — CID 130457879
(3R,4S,7S,9S,11S)-3,4,11-trihydroxy-7-[(Z,4R)-5-hydroxy-4-methylpent-2-en-2-yl]-9-methoxy-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),13,15-trien-5-one (PubChem CID 130457879) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is (3R,4S,7S,9S,11S)-3,4,11-trihydroxy-7-[(Z,4R)-5-hydroxy-4-methylpent-2-en-2-yl]-9-methoxy-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),13,15-trien-5-one.
| Compound Name | (3R,4S,7S,9S,11S)-3,4,11-trihydroxy-7-[(Z,4R)-5-hydroxy-4-methylpent-2-en-2-yl]-9-methoxy-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),13,15-trien-5-one |
|---|---|
| PubChem CID | 130457879 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (3R,4S,7S,9S,11S)-3,4,11-trihydroxy-7-[(Z,4R)-5-hydroxy-4-methylpent-2-en-2-yl]-9-methoxy-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),13,15-trien-5-one |
| SMILES | CO[C@@H]1C[C@@H](/C(C)=C\[C@@H](C)CO)OC(=O)[C@@H](O)[C@H](O)Cc2cccc(c2)C(C)(C)[C@@H](O)C1 |
| InChI | InChI=1S/C25H38O7/c1-15(14-26)9-16(2)21-12-19(31-5)13-22(28)25(3,4)18-8-6-7-17(10-18)11-20(27)23(29)24(30)32-21/h6-10,15,19-23,26-29H,11-14H2,1-5H3/b16-9-/t15-,19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | IUDHTNLQLVVOHR-NWESADDWSA-N |
| XLogP | 1.88 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|