C24H36O7 — CID 130457900
(3R,4S,7S,9R,11S)-3,4,9,11-tetrahydroxy-7-[(Z,4R)-5-hydroxy-4-methylpent-2-en-2-yl]-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),13,15-trien-5-one (PubChem CID 130457900) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is (3R,4S,7S,9R,11S)-3,4,9,11-tetrahydroxy-7-[(Z,4R)-5-hydroxy-4-methylpent-2-en-2-yl]-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),13,15-trien-5-one.
| Compound Name | (3R,4S,7S,9R,11S)-3,4,9,11-tetrahydroxy-7-[(Z,4R)-5-hydroxy-4-methylpent-2-en-2-yl]-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),13,15-trien-5-one |
|---|---|
| PubChem CID | 130457900 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (3R,4S,7S,9R,11S)-3,4,9,11-tetrahydroxy-7-[(Z,4R)-5-hydroxy-4-methylpent-2-en-2-yl]-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),13,15-trien-5-one |
| SMILES | C/C(=C/[C@@H](C)CO)[C@@H]1C[C@H](O)C[C@H](O)C(C)(C)c2cccc(c2)C[C@@H](O)[C@H](O)C(=O)O1 |
| InChI | InChI=1S/C24H36O7/c1-14(13-25)8-15(2)20-11-18(26)12-21(28)24(3,4)17-7-5-6-16(9-17)10-19(27)22(29)23(30)31-20/h5-9,14,18-22,25-29H,10-13H2,1-4H3/b15-8-/t14-,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | UGJHKTMTZDSTDU-HQTRZRHFSA-N |
| XLogP | 1.23 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|