About 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole
3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole (PubChem CID 130458448) has the molecular formula C12H25N3O4
and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole |
| PubChem CID | 130458448 |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole |
| SMILES | COCCOCCOCCOCCN1C=C(C)NN1 |
| InChI | InChI=1S/C12H25N3O4/c1-12-11-15(14-13-12)3-4-17-7-8-19-10-9-18-6-5-16-2/h11,13-14H,3-10H2,1-2H3 |
| InChIKey | NNUDRKVZPSGQRS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole?
The IUPAC name of 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole (CID 130458448) is 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole.
What is the SMILES notation for 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole?
The canonical SMILES for 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole is COCCOCCOCCOCCN1C=C(C)NN1.
What is the InChIKey of 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole?
The InChIKey is NNUDRKVZPSGQRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O4/c1-12-11-15(14-13-12)3-4-17-7-8-19-10-9-18-6-5-16-2/h11,13-14H,3-10H2,1-2H3.
What are the key properties of 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole?
3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole has a molecular weight of 275.35 g/mol, XLogP of -0.13, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methyl-1,2-dihydrotriazole is sourced from PubChem (CID 130458448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).