C10H13N5O5 — CID 130458478
1,3-dimethyl-5-[2-(3-methyl-2,4-dioxo-1,3-diazetidin-1-yl)ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 130458478) has the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. Its IUPAC name is 1,3-dimethyl-5-[2-(3-methyl-2,4-dioxo-1,3-diazetidin-1-yl)ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[2-(3-methyl-2,4-dioxo-1,3-diazetidin-1-yl)ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 130458478 |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1,3-dimethyl-5-[2-(3-methyl-2,4-dioxo-1,3-diazetidin-1-yl)ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(CCn2c(=O)n(C)c(=O)n(C)c2=O)C1=O |
| InChI | InChI=1S/C10H13N5O5/c1-11-6(16)12(2)8(18)14(7(11)17)4-5-15-9(19)13(3)10(15)20/h4-5H2,1-3H3 |
| InChIKey | ONEAPQUGKBAORK-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 106.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |