C44H82N2O — CID 130459048
3-[2-(dimethylamino)ethyl]-N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]oxiran-2-amine (PubChem CID 130459048) has the molecular formula C44H82N2O and a molecular weight of 655.15 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]oxiran-2-amine.
| Compound Name | 3-[2-(dimethylamino)ethyl]-N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]oxiran-2-amine |
|---|---|
| PubChem CID | 130459048 |
| Molecular Formula | C44H82N2O |
| Molecular Weight | 655.15 g/mol |
| Exact Mass | 654.64 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]oxiran-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CNC1OC1CCN(C)C |
| InChI | InChI=1S/C44H82N2O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(41-45-44-43(47-44)39-40-46(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42-45H,5-12,17-18,23-41H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | QAIXZGGHDWZDAH-KWXKLSQISA-N |
| XLogP | 13.28 |
| TPSA | 27.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.15 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|