C39H71NO — CID 130459165
N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]formamide (PubChem CID 130459165) has the molecular formula C39H71NO and a molecular weight of 570.00 g/mol. Its IUPAC name is N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]formamide.
| Compound Name | N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]formamide |
|---|---|
| PubChem CID | 130459165 |
| Molecular Formula | C39H71NO |
| Molecular Weight | 570.00 g/mol |
| Exact Mass | 569.55 |
| IUPAC Name | N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]formamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CNC=O |
| InChI | InChI=1S/C39H71NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(37-40-38-41)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,38-39H,3-10,15-16,21-37H2,1-2H3,(H,40,41)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | UEDNZCOGGLURHS-MAZCIEHSSA-N |
| XLogP | 12.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.00 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|