C15H26N2 — CID 130459530
N,4-dimethyl-N-[(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enyl]cyclohexan-1-amine (PubChem CID 130459530) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N,4-dimethyl-N-[(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enyl]cyclohexan-1-amine.
| Compound Name | N,4-dimethyl-N-[(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 130459530 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N,4-dimethyl-N-[(Z,2E)-2-[(methylideneamino)methylidene]pent-3-enyl]cyclohexan-1-amine |
| SMILES | C=N/C=C(\C=C/C)CN(C)C1CCC(C)CC1 |
| InChI | InChI=1S/C15H26N2/c1-5-6-14(11-16-3)12-17(4)15-9-7-13(2)8-10-15/h5-6,11,13,15H,3,7-10,12H2,1-2,4H3/b6-5-,14-11+ |
| InChIKey | DJPCYEDVUKHCOG-OQSGZJJPSA-N |
| XLogP | 3.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|