C9H19NO — CID 130459704
2,3-dimethyl-3-(2-methylpropyl)-1,2-oxazolidine (PubChem CID 130459704) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 2,3-dimethyl-3-(2-methylpropyl)-1,2-oxazolidine.
| Compound Name | 2,3-dimethyl-3-(2-methylpropyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 130459704 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2,3-dimethyl-3-(2-methylpropyl)-1,2-oxazolidine |
| SMILES | CC(C)CC1(C)CCON1C |
| InChI | InChI=1S/C9H19NO/c1-8(2)7-9(3)5-6-11-10(9)4/h8H,5-7H2,1-4H3 |
| InChIKey | ZHUSDZZGSHFXNZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |