C39H18F12N4 — CID 130460121
[2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-cyanoimino-10a-methyl-6aH-indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 130460121) has the molecular formula C39H18F12N4 and a molecular weight of 770.58 g/mol. Its IUPAC name is [2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-cyanoimino-10a-methyl-6aH-indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-cyanoimino-10a-methyl-6aH-indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 130460121 |
| Molecular Formula | C39H18F12N4 |
| Molecular Weight | 770.58 g/mol |
| Exact Mass | 770.13 |
| IUPAC Name | [2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-cyanoimino-10a-methyl-6aH-indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | CC12C=CC(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)=CC1/C(=N/C#N)c1cc3c(cc12)/C(=N/C#N)c1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1-3 |
| InChI | InChI=1S/C39H18F12N4/c1-35-5-4-19(21-8-24(38(46,47)48)13-25(9-21)39(49,50)51)11-32(35)34(55-17-53)30-14-27-26-3-2-18(10-28(26)33(54-16-52)29(27)15-31(30)35)20-6-22(36(40,41)42)12-23(7-20)37(43,44)45/h2-15,32H,1H3/b54-33+,55-34+ |
| InChIKey | LKLZYTPYZBXFIM-LOJCVJQSSA-N |
| XLogP | 11.54 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.58 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|