C9H12F6O — CID 130460440
5-(1,1-difluoropropoxy)-4,4,5,5-tetrafluoro-2-methylpent-1-ene (PubChem CID 130460440) has the molecular formula C9H12F6O and a molecular weight of 250.18 g/mol. Its IUPAC name is 5-(1,1-difluoropropoxy)-4,4,5,5-tetrafluoro-2-methylpent-1-ene.
| Compound Name | 5-(1,1-difluoropropoxy)-4,4,5,5-tetrafluoro-2-methylpent-1-ene |
|---|---|
| PubChem CID | 130460440 |
| Molecular Formula | C9H12F6O |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 5-(1,1-difluoropropoxy)-4,4,5,5-tetrafluoro-2-methylpent-1-ene |
| SMILES | C=C(C)CC(F)(F)C(F)(F)OC(F)(F)CC |
| InChI | InChI=1S/C9H12F6O/c1-4-8(12,13)16-9(14,15)7(10,11)5-6(2)3/h2,4-5H2,1,3H3 |
| InChIKey | IRRDRHUTSYUQPC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|