About [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol
[4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol (PubChem CID 130461056) has the molecular formula C13H21NS
and a molecular weight of 223.38 g/mol. Its IUPAC name is [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol.
Molecular Properties
| Compound Name | [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol |
| PubChem CID | 130461056 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol |
| SMILES | SCC1C=CC(CN2CCCCC2)=CC1 |
| InChI | InChI=1S/C13H21NS/c15-11-13-6-4-12(5-7-13)10-14-8-2-1-3-9-14/h4-6,13,15H,1-3,7-11H2 |
| InChIKey | VVZJJGCAEKICIS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol?
The IUPAC name of [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol (CID 130461056) is [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol.
What is the SMILES notation for [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol?
The canonical SMILES for [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol is SCC1C=CC(CN2CCCCC2)=CC1.
What is the InChIKey of [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol?
The InChIKey is VVZJJGCAEKICIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NS/c15-11-13-6-4-12(5-7-13)10-14-8-2-1-3-9-14/h4-6,13,15H,1-3,7-11H2.
What are the key properties of [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol?
[4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol has a molecular weight of 223.38 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(piperidin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol is sourced from PubChem (CID 130461056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).