C24H30ClN9O2S — CID 130461134
3,5-diamino-6-chloro-N-[8-[3-(cyclopentylamino)sulfanylbenzoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide (PubChem CID 130461134) has the molecular formula C24H30ClN9O2S and a molecular weight of 544.09 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[8-[3-(cyclopentylamino)sulfanylbenzoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[8-[3-(cyclopentylamino)sulfanylbenzoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 130461134 |
| Molecular Formula | C24H30ClN9O2S |
| Molecular Weight | 544.09 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[8-[3-(cyclopentylamino)sulfanylbenzoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide |
| SMILES | Nc1nc(N)c(C(=O)NC2=NCC3(CCN(C(=O)c4cccc(SNC5CCCC5)c4)CC3)N2)nc1Cl |
| InChI | InChI=1S/C24H30ClN9O2S/c25-18-20(27)30-19(26)17(29-18)21(35)31-23-28-13-24(32-23)8-10-34(11-9-24)22(36)14-4-3-7-16(12-14)37-33-15-5-1-2-6-15/h3-4,7,12,15,33H,1-2,5-6,8-11,13H2,(H4,26,27,30)(H2,28,31,32,35) |
| InChIKey | OGBNAJVXSZSELE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.09 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|