C24H18BrCl2N3O3 — CID 1304616
(5S)-1-(4-bromophenyl)-5-[(2,3-dichlorophenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 1304616) has the molecular formula C24H18BrCl2N3O3 and a molecular weight of 547.24 g/mol. Its IUPAC name is (5S)-1-(4-bromophenyl)-5-[(2,3-dichlorophenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-(4-bromophenyl)-5-[(2,3-dichlorophenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1304616 |
| Molecular Formula | C24H18BrCl2N3O3 |
| Molecular Weight | 547.24 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | (5S)-1-(4-bromophenyl)-5-[(2,3-dichlorophenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)[C@](CCc2ccncc2)(Cc2cccc(Cl)c2Cl)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H18BrCl2N3O3/c25-17-4-6-18(7-5-17)30-22(32)24(21(31)29-23(30)33,11-8-15-9-12-28-13-10-15)14-16-2-1-3-19(26)20(16)27/h1-7,9-10,12-13H,8,11,14H2,(H,29,31,33)/t24-/m0/s1 |
| InChIKey | SMSOKPXVDHTHHH-DEOSSOPVSA-N |
| XLogP | 5.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.24 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|