About 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate
4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 130461863) has the molecular formula C18H32O3
and a molecular weight of 296.45 g/mol. Its IUPAC name is 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| PubChem CID | 130461863 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | C=CC(=O)CCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H32O3/c1-9-14(19)11-10-12-21-15(20)18(8,17(5,6)7)13-16(2,3)4/h9H,1,10-13H2,2-8H3 |
| InChIKey | JZXGOUGBBJXMQB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The IUPAC name of 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate (CID 130461863) is 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The canonical SMILES for 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate is C=CC(=O)CCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The InChIKey is JZXGOUGBBJXMQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O3/c1-9-14(19)11-10-12-21-15(20)18(8,17(5,6)7)13-16(2,3)4/h9H,1,10-13H2,2-8H3.
What are the key properties of 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate?
4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate has a molecular weight of 296.45 g/mol, XLogP of 4.55, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohex-5-enyl 2-tert-butyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 130461863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).