About (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate
(7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 130462242) has the molecular formula C20H29NO6
and a molecular weight of 379.45 g/mol. Its IUPAC name is (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| PubChem CID | 130462242 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)CCCCCCOC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C20H29NO6/c1-26-19(24)6-4-2-3-5-13-27-20(25)16-9-7-15(8-10-16)14-21-17(22)11-12-18(21)23/h11-12,15-16H,2-10,13-14H2,1H3 |
| InChIKey | SBGWEFANNADHAR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate?
The IUPAC name of (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (CID 130462242) is (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
What is the SMILES notation for (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate?
The canonical SMILES for (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate is COC(=O)CCCCCCOC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1.
What is the InChIKey of (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate?
The InChIKey is SBGWEFANNADHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO6/c1-26-19(24)6-4-2-3-5-13-27-20(25)16-9-7-15(8-10-16)14-21-17(22)11-12-18(21)23/h11-12,15-16H,2-10,13-14H2,1H3.
What are the key properties of (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate?
(7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate has a molecular weight of 379.45 g/mol, XLogP of 2.38, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-7-oxoheptyl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 130462242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).