C20H16O4 — CID 130462311
1-[(1S)-2,3-dihydroxy-1,8a-dihydronaphthalen-1-yl]naphthalene-2,3-diol (PubChem CID 130462311) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-[(1S)-2,3-dihydroxy-1,8a-dihydronaphthalen-1-yl]naphthalene-2,3-diol.
| Compound Name | 1-[(1S)-2,3-dihydroxy-1,8a-dihydronaphthalen-1-yl]naphthalene-2,3-diol |
|---|---|
| PubChem CID | 130462311 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-[(1S)-2,3-dihydroxy-1,8a-dihydronaphthalen-1-yl]naphthalene-2,3-diol |
| SMILES | OC1=C(O)[C@H](c2c(O)c(O)cc3ccccc23)C2C=CC=CC2=C1 |
| InChI | InChI=1S/C20H16O4/c21-15-9-11-5-1-3-7-13(11)17(19(15)23)18-14-8-4-2-6-12(14)10-16(22)20(18)24/h1-10,13,17,21-24H/t13?,17-/m0/s1 |
| InChIKey | HAFXWIVIUHBTAF-RUINGEJQSA-N |
| XLogP | 4.34 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|