About oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium
oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium (PubChem CID 130464344) has the molecular formula C6H11F3O5PS+
and a molecular weight of 283.18 g/mol. Its IUPAC name is oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium.
Molecular Properties
| Compound Name | oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium |
| PubChem CID | 130464344 |
| Molecular Formula | C6H11F3O5PS+ |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium |
| SMILES | CC(C)O[P+](=O)C(OS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C6H11F3O5PS/c1-4(2)13-15(10)5(6(7,8)9)14-16(3,11)12/h4-5H,1-3H3/q+1 |
| InChIKey | SGMJOXJCVGCXAH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium?
The IUPAC name of oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium (CID 130464344) is oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium.
What is the SMILES notation for oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium?
The canonical SMILES for oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium is CC(C)O[P+](=O)C(OS(C)(=O)=O)C(F)(F)F.
What is the InChIKey of oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium?
The InChIKey is SGMJOXJCVGCXAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3O5PS/c1-4(2)13-15(10)5(6(7,8)9)14-16(3,11)12/h4-5H,1-3H3/q+1.
What are the key properties of oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium?
oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium has a molecular weight of 283.18 g/mol, XLogP of 2.02, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-propan-2-yloxy-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)phosphanium is sourced from PubChem (CID 130464344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).