About N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide
N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide (PubChem CID 130464671) has the molecular formula C19H23N5O3
and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide |
| PubChem CID | 130464671 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide |
| SMILES | COCCn1cc(C(=O)Nc2ccc3cc(C(=O)C(C)(C)C)cn3c2)nn1 |
| InChI | InChI=1S/C19H23N5O3/c1-19(2,3)17(25)13-9-15-6-5-14(11-23(15)10-13)20-18(26)16-12-24(22-21-16)7-8-27-4/h5-6,9-12H,7-8H2,1-4H3,(H,20,26) |
| InChIKey | HYRVTGXDRIYDTG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide?
The IUPAC name of N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide (CID 130464671) is N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide.
What is the SMILES notation for N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide?
The canonical SMILES for N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide is COCCn1cc(C(=O)Nc2ccc3cc(C(=O)C(C)(C)C)cn3c2)nn1.
What is the InChIKey of N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide?
The InChIKey is HYRVTGXDRIYDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5O3/c1-19(2,3)17(25)13-9-15-6-5-14(11-23(15)10-13)20-18(26)16-12-24(22-21-16)7-8-27-4/h5-6,9-12H,7-8H2,1-4H3,(H,20,26).
What are the key properties of N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide?
N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide has a molecular weight of 369.43 g/mol, XLogP of 2.66, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-dimethylpropanoyl)indolizin-6-yl]-1-(2-methoxyethyl)triazole-4-carboxamide is sourced from PubChem (CID 130464671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).