About (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine
(5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine (PubChem CID 13046498) has the molecular formula C4H9N5
and a molecular weight of 127.15 g/mol. Its IUPAC name is (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine.
Molecular Properties
| Compound Name | (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine |
| PubChem CID | 13046498 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine |
| SMILES | CCc1nc(NN)n[nH]1 |
| InChI | InChI=1S/C4H9N5/c1-2-3-6-4(7-5)9-8-3/h2,5H2,1H3,(H2,6,7,8,9) |
| InChIKey | MKBANHDYXWZZRO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine?
The IUPAC name of (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine (CID 13046498) is (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine.
What is the SMILES notation for (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine?
The canonical SMILES for (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine is CCc1nc(NN)n[nH]1.
What is the InChIKey of (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine?
The InChIKey is MKBANHDYXWZZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N5/c1-2-3-6-4(7-5)9-8-3/h2,5H2,1H3,(H2,6,7,8,9).
What are the key properties of (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine?
(5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine has a molecular weight of 127.15 g/mol, XLogP of -0.35, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1H-1,2,4-triazol-3-yl)hydrazine is sourced from PubChem (CID 13046498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).