About (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine
(5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine (PubChem CID 13046502) has the molecular formula C5H11N5
and a molecular weight of 141.18 g/mol. Its IUPAC name is (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine.
Molecular Properties
| Compound Name | (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine |
| PubChem CID | 13046502 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine |
| SMILES | CC(C)c1nc(NN)n[nH]1 |
| InChI | InChI=1S/C5H11N5/c1-3(2)4-7-5(8-6)10-9-4/h3H,6H2,1-2H3,(H2,7,8,9,10) |
| InChIKey | FRUYZBKOGXIPOA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine?
The IUPAC name of (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine (CID 13046502) is (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine.
What is the SMILES notation for (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine?
The canonical SMILES for (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine is CC(C)c1nc(NN)n[nH]1.
What is the InChIKey of (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine?
The InChIKey is FRUYZBKOGXIPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N5/c1-3(2)4-7-5(8-6)10-9-4/h3H,6H2,1-2H3,(H2,7,8,9,10).
What are the key properties of (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine?
(5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine has a molecular weight of 141.18 g/mol, XLogP of 0.21, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propan-2-yl-1H-1,2,4-triazol-3-yl)hydrazine is sourced from PubChem (CID 13046502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).