C12H19NO — CID 130466254
(2E,8aS)-2-ethylidene-6,8-dimethyl-1,3,6,7,8,8a-hexahydroindolizin-5-one (PubChem CID 130466254) has the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. Its IUPAC name is (2E,8aS)-2-ethylidene-6,8-dimethyl-1,3,6,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | (2E,8aS)-2-ethylidene-6,8-dimethyl-1,3,6,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 130466254 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,8aS)-2-ethylidene-6,8-dimethyl-1,3,6,7,8,8a-hexahydroindolizin-5-one |
| SMILES | C/C=C/1\C[C@H]2C(CC(C(=O)N2C1)C)C |
| InChI | InChI=1S/C12H19NO/c1-4-10-6-11-8(2)5-9(3)12(14)13(11)7-10/h4,8-9,11H,5-7H2,1-3H3/b10-4+/t8?,9?,11-/m0/s1 |
| InChIKey | NNVZKMMCCPYXGP-GWVRQXOPSA-N |
| XLogP | 1.80 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 282 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|