C36H35FN8O4 — CID 130466330
N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(5-fluoro-3-pyridinyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide (PubChem CID 130466330) has the molecular formula C36H35FN8O4 and a molecular weight of 662.73 g/mol. Its IUPAC name is N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(5-fluoro-3-pyridinyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide.
| Compound Name | N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(5-fluoro-3-pyridinyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 130466330 |
| Molecular Formula | C36H35FN8O4 |
| Molecular Weight | 662.73 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(5-fluoro-3-pyridinyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(c2cc(-c3ccc(NC(=O)c4cc5c(n(-c6cncc(F)c6)c4=O)CCCC5=O)cc3)c3c(N)ncnn23)CC1 |
| InChI | InChI=1S/C36H35FN8O4/c1-20(2)35(48)43-12-10-22(11-13-43)30-16-26(32-33(38)40-19-41-45(30)32)21-6-8-24(9-7-21)42-34(47)28-15-27-29(4-3-5-31(27)46)44(36(28)49)25-14-23(37)17-39-18-25/h6-9,14-20,22H,3-5,10-13H2,1-2H3,(H,42,47)(H2,38,40,41) |
| InChIKey | HGCBYFSUGMNLRS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.73 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |