C21H32O3S — CID 130466500
[(1S,4S,5R,9S,12S,13S)-5,9-dimethyl-13-(methylsulfanylmethyl)-14-oxo-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl] formate (PubChem CID 130466500) has the molecular formula C21H32O3S and a molecular weight of 364.55 g/mol. Its IUPAC name is [(1S,4S,5R,9S,12S,13S)-5,9-dimethyl-13-(methylsulfanylmethyl)-14-oxo-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl] formate.
| Compound Name | [(1S,4S,5R,9S,12S,13S)-5,9-dimethyl-13-(methylsulfanylmethyl)-14-oxo-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl] formate |
|---|---|
| PubChem CID | 130466500 |
| Molecular Formula | C21H32O3S |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [(1S,4S,5R,9S,12S,13S)-5,9-dimethyl-13-(methylsulfanylmethyl)-14-oxo-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl] formate |
| SMILES | CSC[C@@H]1C(=O)[C@]23CC[C@H]1CC2[C@]1(C)CCC[C@@](C)(OC=O)[C@H]1CC3 |
| InChI | InChI=1S/C21H32O3S/c1-19-7-4-8-20(2,24-13-22)16(19)6-10-21-9-5-14(11-17(19)21)15(12-25-3)18(21)23/h13-17H,4-12H2,1-3H3/t14-,15-,16-,17?,19+,20+,21-/m0/s1 |
| InChIKey | GYAVBHJKKMXAQH-XEDFAEMYSA-N |
| XLogP | 4.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|