C6H8F3O6P — CID 130466587
4-[methoxy(2,2,2-trifluoroethoxy)phosphoryl]-1,3-dioxolan-2-one (PubChem CID 130466587) has the molecular formula C6H8F3O6P and a molecular weight of 264.09 g/mol. Its IUPAC name is 4-[methoxy(2,2,2-trifluoroethoxy)phosphoryl]-1,3-dioxolan-2-one.
| Compound Name | 4-[methoxy(2,2,2-trifluoroethoxy)phosphoryl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 130466587 |
| Molecular Formula | C6H8F3O6P |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 4-[methoxy(2,2,2-trifluoroethoxy)phosphoryl]-1,3-dioxolan-2-one |
| SMILES | COP(=O)(OCC(F)(F)F)C1COC(=O)O1 |
| InChI | InChI=1S/C6H8F3O6P/c1-12-16(11,14-3-6(7,8)9)4-2-13-5(10)15-4/h4H,2-3H2,1H3 |
| InChIKey | SHVVJIWMWOLCOT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|