C17H32FNO10 — CID 130466607
(2S,4S,5R)-2-[(3S,4R,6R)-6-(5-aminopentoxy)-2-(fluoromethyl)-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 130466607) has the molecular formula C17H32FNO10 and a molecular weight of 429.44 g/mol. Its IUPAC name is (2S,4S,5R)-2-[(3S,4R,6R)-6-(5-aminopentoxy)-2-(fluoromethyl)-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,4S,5R)-2-[(3S,4R,6R)-6-(5-aminopentoxy)-2-(fluoromethyl)-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 130466607 |
| Molecular Formula | C17H32FNO10 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (2S,4S,5R)-2-[(3S,4R,6R)-6-(5-aminopentoxy)-2-(fluoromethyl)-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | NCCCCCO[C@@H]1OC(CF)[C@@H](O[C@@H]2OC(CO)[C@H](O)[C@H](O)C2O)[C@H](O)C1O |
| InChI | InChI=1S/C17H32FNO10/c18-6-8-15(29-17-13(24)11(22)10(21)9(7-20)28-17)12(23)14(25)16(27-8)26-5-3-1-2-4-19/h8-17,20-25H,1-7,19H2/t8?,9?,10-,11-,12+,13?,14?,15+,16+,17-/m0/s1 |
| InChIKey | XPDVUMADCBROBT-MUNNJTLISA-N |
| XLogP | -3.27 |
| TPSA | 184.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|