C43H81NO — CID 130466641
(6Z,9Z,28Z,31Z)-19-[4-(dimethylamino)butyl]heptatriaconta-6,9,28,31-tetraen-19-ol (PubChem CID 130466641) has the molecular formula C43H81NO and a molecular weight of 628.13 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-19-[4-(dimethylamino)butyl]heptatriaconta-6,9,28,31-tetraen-19-ol.
| Compound Name | (6Z,9Z,28Z,31Z)-19-[4-(dimethylamino)butyl]heptatriaconta-6,9,28,31-tetraen-19-ol |
|---|---|
| PubChem CID | 130466641 |
| Molecular Formula | C43H81NO |
| Molecular Weight | 628.13 g/mol |
| Exact Mass | 627.63 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-19-[4-(dimethylamino)butyl]heptatriaconta-6,9,28,31-tetraen-19-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCN(C)C |
| InChI | InChI=1S/C43H81NO/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-43(45,41-37-38-42-44(3)4)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,45H,5-12,17-18,23-42H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | IBULSNQZVGSCNZ-KWXKLSQISA-N |
| XLogP | 13.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.13 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|