About 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one
4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one (PubChem CID 130466643) has the molecular formula C7H9F4O6P
and a molecular weight of 296.11 g/mol. Its IUPAC name is 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one |
| PubChem CID | 130466643 |
| Molecular Formula | C7H9F4O6P |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(P(=O)(OCC(F)F)OCC(F)F)O1 |
| InChI | InChI=1S/C7H9F4O6P/c8-4(9)1-15-18(13,16-2-5(10)11)6-3-14-7(12)17-6/h4-6H,1-3H2 |
| InChIKey | CEQUQXNLNBKHFW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one?
The IUPAC name of 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one (CID 130466643) is 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one.
What is the SMILES notation for 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one?
The canonical SMILES for 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one is O=C1OCC(P(=O)(OCC(F)F)OCC(F)F)O1.
What is the InChIKey of 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one?
The InChIKey is CEQUQXNLNBKHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F4O6P/c8-4(9)1-15-18(13,16-2-5(10)11)6-3-14-7(12)17-6/h4-6H,1-3H2.
What are the key properties of 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one?
4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one has a molecular weight of 296.11 g/mol, XLogP of 2.24, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(2,2-difluoroethoxy)phosphoryl]-1,3-dioxolan-2-one is sourced from PubChem (CID 130466643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).