C14H27NO3S — CID 130466649
5,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-4-oxo-N-(2-sulfanylethyl)hexanamide (PubChem CID 130466649) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-4-oxo-N-(2-sulfanylethyl)hexanamide.
| Compound Name | 5,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-4-oxo-N-(2-sulfanylethyl)hexanamide |
|---|---|
| PubChem CID | 130466649 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 5,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-4-oxo-N-(2-sulfanylethyl)hexanamide |
| SMILES | CC(C)(C)OC(CC(=O)C(C)(C)C)C(=O)NCCS |
| InChI | InChI=1S/C14H27NO3S/c1-13(2,3)11(16)9-10(18-14(4,5)6)12(17)15-7-8-19/h10,19H,7-9H2,1-6H3,(H,15,17) |
| InChIKey | OSHLKZOSEXTYHA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|