About (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine
(5Z,6E)-5,6-di(ethylidene)pyridin-2-amine (PubChem CID 130466666) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine.
Molecular Properties
| Compound Name | (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine |
| PubChem CID | 130466666 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine |
| SMILES | C/C=c1/ccc(N)n/c1=C/C |
| InChI | InChI=1S/C9H12N2/c1-3-7-5-6-9(10)11-8(7)4-2/h3-6H,1-2H3,(H2,10,11)/b7-3-,8-4+ |
| InChIKey | HNVGXAQGVRUGBD-KYPMKJFLSA-N |
| XLogP | 0.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine?
The IUPAC name of (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine (CID 130466666) is (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine.
What is the SMILES notation for (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine?
The canonical SMILES for (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine is C/C=c1/ccc(N)n/c1=C/C.
What is the InChIKey of (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine?
The InChIKey is HNVGXAQGVRUGBD-KYPMKJFLSA-N. The full InChI is InChI=1S/C9H12N2/c1-3-7-5-6-9(10)11-8(7)4-2/h3-6H,1-2H3,(H2,10,11)/b7-3-,8-4+.
What are the key properties of (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine?
(5Z,6E)-5,6-di(ethylidene)pyridin-2-amine has a molecular weight of 148.21 g/mol, XLogP of 0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6E)-5,6-di(ethylidene)pyridin-2-amine is sourced from PubChem (CID 130466666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).