C23H25N7O5 — CID 130467146
20-methyl-8,13-dioxa-4,5,10,16,19,20,23-heptazapentacyclo[23.3.1.12,5.110,14.018,22]hentriaconta-1(29),2(31),3,18,21,25,27-heptaene-9,17,24-trione (PubChem CID 130467146) has the molecular formula C23H25N7O5 and a molecular weight of 479.50 g/mol. Its IUPAC name is 20-methyl-8,13-dioxa-4,5,10,16,19,20,23-heptazapentacyclo[23.3.1.12,5.110,14.018,22]hentriaconta-1(29),2(31),3,18,21,25,27-heptaene-9,17,24-trione.
| Compound Name | 20-methyl-8,13-dioxa-4,5,10,16,19,20,23-heptazapentacyclo[23.3.1.12,5.110,14.018,22]hentriaconta-1(29),2(31),3,18,21,25,27-heptaene-9,17,24-trione |
|---|---|
| PubChem CID | 130467146 |
| Molecular Formula | C23H25N7O5 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 20-methyl-8,13-dioxa-4,5,10,16,19,20,23-heptazapentacyclo[23.3.1.12,5.110,14.018,22]hentriaconta-1(29),2(31),3,18,21,25,27-heptaene-9,17,24-trione |
| SMILES | Cn1cc2c(n1)C(=O)NCC1CN(CCO1)C(=O)OCCn1cc(cn1)-c1cccc(c1)C(=O)N2 |
| InChI | InChI=1S/C23H25N7O5/c1-28-14-19-20(27-28)22(32)24-11-18-13-29(5-7-34-18)23(33)35-8-6-30-12-17(10-25-30)15-3-2-4-16(9-15)21(31)26-19/h2-4,9-10,12,14,18H,5-8,11,13H2,1H3,(H,24,32)(H,26,31) |
| InChIKey | MRWWRTWRSTVNBI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |