C26H33N7O4S — CID 130467151
16-(4-methylsulfonylcyclohexyl)-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione (PubChem CID 130467151) has the molecular formula C26H33N7O4S and a molecular weight of 539.66 g/mol. Its IUPAC name is 16-(4-methylsulfonylcyclohexyl)-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione.
| Compound Name | 16-(4-methylsulfonylcyclohexyl)-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione |
|---|---|
| PubChem CID | 130467151 |
| Molecular Formula | C26H33N7O4S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 16-(4-methylsulfonylcyclohexyl)-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione |
| SMILES | CS(=O)(=O)C1CCC(n2cc3c(n2)C(=O)NCCCCCCn2cc(cn2)-c2cccc(n2)C(=O)N3)CC1 |
| InChI | InChI=1S/C26H33N7O4S/c1-38(36,37)20-11-9-19(10-12-20)33-17-23-24(31-33)26(35)27-13-4-2-3-5-14-32-16-18(15-28-32)21-7-6-8-22(29-21)25(34)30-23/h6-8,15-17,19-20H,2-5,9-14H2,1H3,(H,27,35)(H,30,34) |
| InChIKey | SZYYBODMVNQZOQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |