About 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole
5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole (PubChem CID 130467178) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole |
| PubChem CID | 130467178 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole |
| SMILES | C[C@H]1C[C@@H]1c1cnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C13H13NO/c1-9-7-11(9)12-8-14-13(15-12)10-5-3-2-4-6-10/h2-6,8-9,11H,7H2,1H3/t9-,11-/m0/s1 |
| InChIKey | NKZQBGLQQMXZNH-ONGXEEELSA-N |
| XLogP | 3.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole?
The IUPAC name of 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole (CID 130467178) is 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole.
What is the SMILES notation for 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole?
The canonical SMILES for 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole is C[C@H]1C[C@@H]1c1cnc(-c2ccccc2)o1.
What is the InChIKey of 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole?
The InChIKey is NKZQBGLQQMXZNH-ONGXEEELSA-N. The full InChI is InChI=1S/C13H13NO/c1-9-7-11(9)12-8-14-13(15-12)10-5-3-2-4-6-10/h2-6,8-9,11H,7H2,1H3/t9-,11-/m0/s1.
What are the key properties of 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole?
5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole has a molecular weight of 199.25 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,2S)-2-methylcyclopropyl]-2-phenyl-1,3-oxazole is sourced from PubChem (CID 130467178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).