C20H23F3O3 — CID 130467334
(1E,4S,10Z,13S)-4-[(Z)-5,5,5-trifluoropent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione (PubChem CID 130467334) has the molecular formula C20H23F3O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is (1E,4S,10Z,13S)-4-[(Z)-5,5,5-trifluoropent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione.
| Compound Name | (1E,4S,10Z,13S)-4-[(Z)-5,5,5-trifluoropent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
|---|---|
| PubChem CID | 130467334 |
| Molecular Formula | C20H23F3O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (1E,4S,10Z,13S)-4-[(Z)-5,5,5-trifluoropent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
| SMILES | O=C1CCC/C=C\C[C@H]2C=CC(=O)/C2=C/C[C@H](C/C=C\CC(F)(F)F)O1 |
| InChI | InChI=1S/C20H23F3O3/c21-20(22,23)14-6-5-8-16-11-12-17-15(10-13-18(17)24)7-3-1-2-4-9-19(25)26-16/h1,3,5-6,10,12-13,15-16H,2,4,7-9,11,14H2/b3-1-,6-5-,17-12+/t15-,16-/m0/s1 |
| InChIKey | AUKWSZDLKDIYOC-UIRHWMMOSA-N |
| XLogP | 5.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|