C12H13F3O2 — CID 130467338
(E,3R)-5-[3-(trifluoromethyl)phenyl]pent-4-ene-1,3-diol (PubChem CID 130467338) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is (E,3R)-5-[3-(trifluoromethyl)phenyl]pent-4-ene-1,3-diol.
| Compound Name | (E,3R)-5-[3-(trifluoromethyl)phenyl]pent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 130467338 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (E,3R)-5-[3-(trifluoromethyl)phenyl]pent-4-ene-1,3-diol |
| SMILES | OCC[C@@H](O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3O2/c13-12(14,15)10-3-1-2-9(8-10)4-5-11(17)6-7-16/h1-5,8,11,16-17H,6-7H2/b5-4+/t11-/m0/s1 |
| InChIKey | XHPATJJCCLDWFR-ZWNMCFTASA-N |
| XLogP | 2.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |